C19H23ClN2O3 — CID 92537927
N-[[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(3-chloro-4-methylphenyl)acetamide (PubChem CID 92537927) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is N-[[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(3-chloro-4-methylphenyl)acetamide.
| Compound Name | N-[[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(3-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 92537927 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(3-chloro-4-methylphenyl)acetamide |
| SMILES | CC(=O)N(CN1C(=O)[C@H]2C[C@@H](C)CC[C@H]2C1=O)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C19H23ClN2O3/c1-11-4-7-15-16(8-11)19(25)22(18(15)24)10-21(13(3)23)14-6-5-12(2)17(20)9-14/h5-6,9,11,15-16H,4,7-8,10H2,1-3H3/t11-,15+,16-/m0/s1 |
| InChIKey | LCZXKQIHHDFEFO-XZJROXQQSA-N |
| XLogP | 3.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|