C19H24N2O3 — CID 7124744
N-[[(3aR,5R,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(4-methylphenyl)acetamide (PubChem CID 7124744) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[[(3aR,5R,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(4-methylphenyl)acetamide.
| Compound Name | N-[[(3aR,5R,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 7124744 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[[(3aR,5R,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(4-methylphenyl)acetamide |
| SMILES | CC(=O)N(CN1C(=O)[C@H]2CC[C@@H](C)C[C@H]2C1=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H24N2O3/c1-12-4-7-15(8-5-12)20(14(3)22)11-21-18(23)16-9-6-13(2)10-17(16)19(21)24/h4-5,7-8,13,16-17H,6,9-11H2,1-3H3/t13-,16+,17-/m1/s1 |
| InChIKey | IGQAEASXXJLBNC-XOKHGSTOSA-N |
| XLogP | 2.73 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|