C19H20N2O3 — CID 98173487
N-[[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]-N-(4-methylphenyl)acetamide (PubChem CID 98173487) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]-N-(4-methylphenyl)acetamide.
| Compound Name | N-[[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 98173487 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]-N-(4-methylphenyl)acetamide |
| SMILES | CC(=O)N(CN1C(=O)[C@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-11-3-7-15(8-4-11)20(12(2)22)10-21-18(23)16-13-5-6-14(9-13)17(16)19(21)24/h3-8,13-14,16-17H,9-10H2,1-2H3/t13-,14-,16+,17+/m0/s1 |
| InChIKey | VXQYZRWZVMFPSK-XJNFMUPTSA-N |
| XLogP | 2.11 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|