C17H21N5O4 — CID 29259834
N'-[3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoyl]pyridine-2-carbohydrazide (PubChem CID 29259834) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is N'-[3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoyl]pyridine-2-carbohydrazide.
| Compound Name | N'-[3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoyl]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 29259834 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N'-[3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoyl]pyridine-2-carbohydrazide |
| SMILES | O=C(CCN1C(=O)NC2(CCCCC2)C1=O)NNC(=O)c1ccccn1 |
| InChI | InChI=1S/C17H21N5O4/c23-13(20-21-14(24)12-6-2-5-10-18-12)7-11-22-15(25)17(19-16(22)26)8-3-1-4-9-17/h2,5-6,10H,1,3-4,7-9,11H2,(H,19,26)(H,20,23)(H,21,24) |
| InChIKey | TXJDGZAJXQARIL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|