C21H24N4O3S — CID 43050602
3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]propanamide (PubChem CID 43050602) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]propanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 43050602 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(2-phenyl-1,3-thiazol-4-yl)methyl]propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCCC2)C1=O)NCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H24N4O3S/c26-17(22-13-16-14-29-18(23-16)15-7-3-1-4-8-15)9-12-25-19(27)21(24-20(25)28)10-5-2-6-11-21/h1,3-4,7-8,14H,2,5-6,9-13H2,(H,22,26)(H,24,28) |
| InChIKey | JHHZKVXKYOBNNR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|