C22H25N3O4S — CID 2928177
N-cyclohexyl-2-[[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]benzamide (PubChem CID 2928177) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]benzamide.
| Compound Name | N-cyclohexyl-2-[[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 2928177 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-cyclohexyl-2-[[2-[(4-nitrophenyl)methylsulfanyl]acetyl]amino]benzamide |
| SMILES | O=C(CSCc1ccc([N+](=O)[O-])cc1)Nc1ccccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H25N3O4S/c26-21(15-30-14-16-10-12-18(13-11-16)25(28)29)24-20-9-5-4-8-19(20)22(27)23-17-6-2-1-3-7-17/h4-5,8-13,17H,1-3,6-7,14-15H2,(H,23,27)(H,24,26) |
| InChIKey | MIODZKMXAJPIHX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|