C19H25N3O4S — CID 29285075
N,N-diethyl-4-(3-phenylfuran-2-carbonyl)piperazine-1-sulfonamide (PubChem CID 29285075) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is N,N-diethyl-4-(3-phenylfuran-2-carbonyl)piperazine-1-sulfonamide.
| Compound Name | N,N-diethyl-4-(3-phenylfuran-2-carbonyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 29285075 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N,N-diethyl-4-(3-phenylfuran-2-carbonyl)piperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(=O)c2occc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C19H25N3O4S/c1-3-21(4-2)27(24,25)22-13-11-20(12-14-22)19(23)18-17(10-15-26-18)16-8-6-5-7-9-16/h5-10,15H,3-4,11-14H2,1-2H3 |
| InChIKey | DHVXXCMDSSYNPW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |