C19H26N2O — CID 2928659
2-spiro[4H-isoquinoline-3,1'-cyclohexane]-1-ylpentanamide (PubChem CID 2928659) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-spiro[4H-isoquinoline-3,1'-cyclohexane]-1-ylpentanamide.
| Compound Name | 2-spiro[4H-isoquinoline-3,1'-cyclohexane]-1-ylpentanamide |
|---|---|
| PubChem CID | 2928659 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 2-spiro[4H-isoquinoline-3,1'-cyclohexane]-1-ylpentanamide |
| SMILES | CCCC(C(N)=O)C1=NC2(CCCCC2)Cc2ccccc21 |
| InChI | InChI=1S/C19H26N2O/c1-2-8-16(18(20)22)17-15-10-5-4-9-14(15)13-19(21-17)11-6-3-7-12-19/h4-5,9-10,16H,2-3,6-8,11-13H2,1H3,(H2,20,22) |
| InChIKey | QMCLDAYMXJVDHJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |