C20H24N2O3S2 — CID 2929746
ethyl 2-(phenylcarbamothioylamino)-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate (PubChem CID 2929746) has the molecular formula C20H24N2O3S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is ethyl 2-(phenylcarbamothioylamino)-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate.
| Compound Name | ethyl 2-(phenylcarbamothioylamino)-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate |
|---|---|
| PubChem CID | 2929746 |
| Molecular Formula | C20H24N2O3S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | ethyl 2-(phenylcarbamothioylamino)-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)Nc2ccccc2)sc2c1CC(C(C)C)OC2 |
| InChI | InChI=1S/C20H24N2O3S2/c1-4-24-19(23)17-14-10-15(12(2)3)25-11-16(14)27-18(17)22-20(26)21-13-8-6-5-7-9-13/h5-9,12,15H,4,10-11H2,1-3H3,(H2,21,22,26) |
| InChIKey | NKSCSIOCZPTFJQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|