C21H24N2O4S2 — CID 1212809
ethyl (5S)-2-(benzoylcarbamothioylamino)-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate (PubChem CID 1212809) has the molecular formula C21H24N2O4S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is ethyl (5S)-2-(benzoylcarbamothioylamino)-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate.
| Compound Name | ethyl (5S)-2-(benzoylcarbamothioylamino)-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate |
|---|---|
| PubChem CID | 1212809 |
| Molecular Formula | C21H24N2O4S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | ethyl (5S)-2-(benzoylcarbamothioylamino)-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC(=O)c2ccccc2)sc2c1C[C@@H](C(C)C)OC2 |
| InChI | InChI=1S/C21H24N2O4S2/c1-4-26-20(25)17-14-10-15(12(2)3)27-11-16(14)29-19(17)23-21(28)22-18(24)13-8-6-5-7-9-13/h5-9,12,15H,4,10-11H2,1-3H3,(H2,22,23,24,28)/t15-/m0/s1 |
| InChIKey | ZMKPIAINRVCEQF-HNNXBMFYSA-N |
| XLogP | 4.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|