C17H21NO6S — CID 2936208
4-[(3-ethoxycarbonyl-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-2-yl)amino]-4-oxobut-2-enoic acid (PubChem CID 2936208) has the molecular formula C17H21NO6S and a molecular weight of 367.42 g/mol. Its IUPAC name is 4-[(3-ethoxycarbonyl-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-2-yl)amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[(3-ethoxycarbonyl-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-2-yl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 2936208 |
| Molecular Formula | C17H21NO6S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 4-[(3-ethoxycarbonyl-5-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyran-2-yl)amino]-4-oxobut-2-enoic acid |
| SMILES | CCOC(=O)c1c(NC(=O)C=CC(=O)O)sc2c1CC(C(C)C)OC2 |
| InChI | InChI=1S/C17H21NO6S/c1-4-23-17(22)15-10-7-11(9(2)3)24-8-12(10)25-16(15)18-13(19)5-6-14(20)21/h5-6,9,11H,4,7-8H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | OSCOUEYRVLSPSU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|