C21H21NO4S — CID 2931442
2-[4-(benzenesulfonyl)phenyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 2931442) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)phenyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-[4-(benzenesulfonyl)phenyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2931442 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-[4-(benzenesulfonyl)phenyl]-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC1CCC2C(=O)N(c3ccc(S(=O)(=O)c4ccccc4)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C21H21NO4S/c1-14-7-12-18-19(13-14)21(24)22(20(18)23)15-8-10-17(11-9-15)27(25,26)16-5-3-2-4-6-16/h2-6,8-11,14,18-19H,7,12-13H2,1H3 |
| InChIKey | WBBSDIDBPMPHMQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|