C40H35NO6S2 — CID 101451670
(7S,7aS,10aR,11bS)-2,2-bis(benzenesulfonyl)-7,9-diphenyl-3,5,6,7,7a,10a,11,11b-octahydro-1H-naphtho[1,2-f]isoindole-8,10-dione (PubChem CID 101451670) has the molecular formula C40H35NO6S2 and a molecular weight of 689.86 g/mol. Its IUPAC name is (7S,7aS,10aR,11bS)-2,2-bis(benzenesulfonyl)-7,9-diphenyl-3,5,6,7,7a,10a,11,11b-octahydro-1H-naphtho[1,2-f]isoindole-8,10-dione.
| Compound Name | (7S,7aS,10aR,11bS)-2,2-bis(benzenesulfonyl)-7,9-diphenyl-3,5,6,7,7a,10a,11,11b-octahydro-1H-naphtho[1,2-f]isoindole-8,10-dione |
|---|---|
| PubChem CID | 101451670 |
| Molecular Formula | C40H35NO6S2 |
| Molecular Weight | 689.86 g/mol |
| Exact Mass | 689.19 |
| IUPAC Name | (7S,7aS,10aR,11bS)-2,2-bis(benzenesulfonyl)-7,9-diphenyl-3,5,6,7,7a,10a,11,11b-octahydro-1H-naphtho[1,2-f]isoindole-8,10-dione |
| SMILES | O=C1[C@H]2[C@@H](c3ccccc3)C3=C(C[C@H]2C(=O)N1c1ccccc1)[C@H]1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)CC=C1CC3 |
| InChI | InChI=1S/C40H35NO6S2/c42-38-34-25-33-32(36(28-13-5-1-6-14-28)37(34)39(43)41(38)29-15-7-2-8-16-29)22-21-27-23-24-40(26-35(27)33,48(44,45)30-17-9-3-10-18-30)49(46,47)31-19-11-4-12-20-31/h1-20,23,34-37H,21-22,24-26H2/t34-,35+,36+,37-/m1/s1 |
| InChIKey | YKVMGTXOAGNHKG-MVLFYJIESA-N |
| XLogP | 7.05 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.86 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|