C23H21NO4 — CID 11845381
(3aR,11bR,11cS)-9-hydroxy-6,6-dimethyl-2-phenyl-3a,4,11b,11c-tetrahydrochromeno[4,3-e]isoindole-1,3-dione (PubChem CID 11845381) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is (3aR,11bR,11cS)-9-hydroxy-6,6-dimethyl-2-phenyl-3a,4,11b,11c-tetrahydrochromeno[4,3-e]isoindole-1,3-dione.
| Compound Name | (3aR,11bR,11cS)-9-hydroxy-6,6-dimethyl-2-phenyl-3a,4,11b,11c-tetrahydrochromeno[4,3-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11845381 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (3aR,11bR,11cS)-9-hydroxy-6,6-dimethyl-2-phenyl-3a,4,11b,11c-tetrahydrochromeno[4,3-e]isoindole-1,3-dione |
| SMILES | CC1(C)Oc2cc(O)ccc2[C@H]2C1=CC[C@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C23H21NO4/c1-23(2)17-11-10-16-20(19(17)15-9-8-14(25)12-18(15)28-23)22(27)24(21(16)26)13-6-4-3-5-7-13/h3-9,11-12,16,19-20,25H,10H2,1-2H3/t16-,19+,20-/m1/s1 |
| InChIKey | AAWKBXMXBPWVMP-LSTHTHJFSA-N |
| XLogP | 3.78 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|