C35H29NO2 — CID 25270689
(3aS,4S,7aR)-5-(2,2-diphenylethenyl)-6-methyl-2,4-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 25270689) has the molecular formula C35H29NO2 and a molecular weight of 495.62 g/mol. Its IUPAC name is (3aS,4S,7aR)-5-(2,2-diphenylethenyl)-6-methyl-2,4-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,4S,7aR)-5-(2,2-diphenylethenyl)-6-methyl-2,4-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 25270689 |
| Molecular Formula | C35H29NO2 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | (3aS,4S,7aR)-5-(2,2-diphenylethenyl)-6-methyl-2,4-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1=C(C=C(c2ccccc2)c2ccccc2)[C@H](c2ccccc2)[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C35H29NO2/c1-24-22-31-33(35(38)36(34(31)37)28-20-12-5-13-21-28)32(27-18-10-4-11-19-27)29(24)23-30(25-14-6-2-7-15-25)26-16-8-3-9-17-26/h2-21,23,31-33H,22H2,1H3/t31-,32+,33-/m1/s1 |
| InChIKey | NQUAKBFWRLDHTG-XKKJXBDVSA-N |
| XLogP | 7.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|