C22H19NO3 — CID 29315549
(4-oxo-4-phenylbutyl) (E)-3-quinolin-2-ylprop-2-enoate (PubChem CID 29315549) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is (4-oxo-4-phenylbutyl) (E)-3-quinolin-2-ylprop-2-enoate.
| Compound Name | (4-oxo-4-phenylbutyl) (E)-3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 29315549 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (4-oxo-4-phenylbutyl) (E)-3-quinolin-2-ylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccc2ccccc2n1)OCCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19NO3/c24-21(18-8-2-1-3-9-18)11-6-16-26-22(25)15-14-19-13-12-17-7-4-5-10-20(17)23-19/h1-5,7-10,12-15H,6,11,16H2/b15-14+ |
| InChIKey | QVAHQPQIISAKQL-CCEZHUSRSA-N |
| XLogP | 4.45 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|