C22H16N2O4 — CID 71953121
2-(1,3-dioxoisoindol-2-yl)ethyl 3-quinolin-2-ylprop-2-enoate (PubChem CID 71953121) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 3-quinolin-2-ylprop-2-enoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 71953121 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 3-quinolin-2-ylprop-2-enoate |
| SMILES | O=C(C=Cc1ccc2ccccc2n1)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H16N2O4/c25-20(12-11-16-10-9-15-5-1-4-8-19(15)23-16)28-14-13-24-21(26)17-6-2-3-7-18(17)22(24)27/h1-12H,13-14H2 |
| InChIKey | BUZQQVVMPYEXPD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|