C19H13Cl2NO4 — CID 2421425
2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 2421425) has the molecular formula C19H13Cl2NO4 and a molecular weight of 390.22 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2421425 |
| Molecular Formula | C19H13Cl2NO4 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H13Cl2NO4/c20-13-7-5-12(16(21)11-13)6-8-17(23)26-10-9-22-18(24)14-3-1-2-4-15(14)19(22)25/h1-8,11H,9-10H2/b8-6+ |
| InChIKey | ULENCNLLXGKXSO-SOFGYWHQSA-N |
| XLogP | 3.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|