C16H10Cl3FO2 — CID 3610173
(2-chloro-6-fluorophenyl)methyl 3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 3610173) has the molecular formula C16H10Cl3FO2 and a molecular weight of 359.61 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl 3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3610173 |
| Molecular Formula | C16H10Cl3FO2 |
| Molecular Weight | 359.61 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H10Cl3FO2/c17-11-6-4-10(14(19)8-11)5-7-16(21)22-9-12-13(18)2-1-3-15(12)20/h1-8H,9H2 |
| InChIKey | ITGKTSOILFEVCY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|