C19H18Cl2O5 — CID 9095597
(3,4,5-trimethoxyphenyl)methyl (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 9095597) has the molecular formula C19H18Cl2O5 and a molecular weight of 397.25 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl)methyl (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | (3,4,5-trimethoxyphenyl)methyl (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9095597 |
| Molecular Formula | C19H18Cl2O5 |
| Molecular Weight | 397.25 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | (3,4,5-trimethoxyphenyl)methyl (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | COc1cc(COC(=O)/C=C/c2ccc(Cl)cc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C19H18Cl2O5/c1-23-16-8-12(9-17(24-2)19(16)25-3)11-26-18(22)7-5-13-4-6-14(20)10-15(13)21/h4-10H,11H2,1-3H3/b7-5+ |
| InChIKey | GARQPRIUGSSFQU-FNORWQNLSA-N |
| XLogP | 4.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.25 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|