C24H15Cl3N2O4S — CID 42631516
O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(4-chlorophenyl)-N-(3,5-dichlorobenzoyl)carbamothioate (PubChem CID 42631516) has the molecular formula C24H15Cl3N2O4S and a molecular weight of 533.82 g/mol. Its IUPAC name is O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(4-chlorophenyl)-N-(3,5-dichlorobenzoyl)carbamothioate.
| Compound Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(4-chlorophenyl)-N-(3,5-dichlorobenzoyl)carbamothioate |
|---|---|
| PubChem CID | 42631516 |
| Molecular Formula | C24H15Cl3N2O4S |
| Molecular Weight | 533.82 g/mol |
| Exact Mass | 531.98 |
| IUPAC Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(4-chlorophenyl)-N-(3,5-dichlorobenzoyl)carbamothioate |
| SMILES | O=C1c2ccccc2C(=O)N1CCOC(=S)N(C(=O)c1cc(Cl)cc(Cl)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H15Cl3N2O4S/c25-15-5-7-18(8-6-15)29(21(30)14-11-16(26)13-17(27)12-14)24(34)33-10-9-28-22(31)19-3-1-2-4-20(19)23(28)32/h1-8,11-13H,9-10H2 |
| InChIKey | UDNZULXVBVLGFS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.82 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|