C28H19ClN2O4S — CID 42631086
O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(4-chlorophenyl)-N-(naphthalene-1-carbonyl)carbamothioate (PubChem CID 42631086) has the molecular formula C28H19ClN2O4S and a molecular weight of 514.99 g/mol. Its IUPAC name is O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(4-chlorophenyl)-N-(naphthalene-1-carbonyl)carbamothioate.
| Compound Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(4-chlorophenyl)-N-(naphthalene-1-carbonyl)carbamothioate |
|---|---|
| PubChem CID | 42631086 |
| Molecular Formula | C28H19ClN2O4S |
| Molecular Weight | 514.99 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(4-chlorophenyl)-N-(naphthalene-1-carbonyl)carbamothioate |
| SMILES | O=C1c2ccccc2C(=O)N1CCOC(=S)N(C(=O)c1cccc2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H19ClN2O4S/c29-19-12-14-20(15-13-19)31(27(34)22-11-5-7-18-6-1-2-8-21(18)22)28(36)35-17-16-30-25(32)23-9-3-4-10-24(23)26(30)33/h1-15H,16-17H2 |
| InChIKey | YFRGACOCTSKYIH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.99 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|