C24H15Cl2N3O6S — CID 42631618
O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(4-chloro-3-nitrobenzoyl)-N-(4-chlorophenyl)carbamothioate (PubChem CID 42631618) has the molecular formula C24H15Cl2N3O6S and a molecular weight of 544.37 g/mol. Its IUPAC name is O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(4-chloro-3-nitrobenzoyl)-N-(4-chlorophenyl)carbamothioate.
| Compound Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(4-chloro-3-nitrobenzoyl)-N-(4-chlorophenyl)carbamothioate |
|---|---|
| PubChem CID | 42631618 |
| Molecular Formula | C24H15Cl2N3O6S |
| Molecular Weight | 544.37 g/mol |
| Exact Mass | 543.01 |
| IUPAC Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-(4-chloro-3-nitrobenzoyl)-N-(4-chlorophenyl)carbamothioate |
| SMILES | O=C1c2ccccc2C(=O)N1CCOC(=S)N(C(=O)c1ccc(Cl)c([N+](=O)[O-])c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H15Cl2N3O6S/c25-15-6-8-16(9-7-15)28(21(30)14-5-10-19(26)20(13-14)29(33)34)24(36)35-12-11-27-22(31)17-3-1-2-4-18(17)23(27)32/h1-10,13H,11-12H2 |
| InChIKey | ZEPYFWCZWLYGRQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|