C23H14Cl2N3O4S- — CID 20979194
N-[6-chloro-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyridine-3-carbonyl]-N-(4-chlorophenyl)carbamothioate (PubChem CID 20979194) has the molecular formula C23H14Cl2N3O4S- and a molecular weight of 499.36 g/mol. Its IUPAC name is N-[6-chloro-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyridine-3-carbonyl]-N-(4-chlorophenyl)carbamothioate.
| Compound Name | N-[6-chloro-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyridine-3-carbonyl]-N-(4-chlorophenyl)carbamothioate |
|---|---|
| PubChem CID | 20979194 |
| Molecular Formula | C23H14Cl2N3O4S- |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | N-[6-chloro-2-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyridine-3-carbonyl]-N-(4-chlorophenyl)carbamothioate |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1nc(Cl)ccc1C(=O)N(C(=O)[S-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H15Cl2N3O4S/c24-13-5-7-14(8-6-13)28(23(32)33)22(31)17-9-10-19(25)26-18(17)11-12-27-20(29)15-3-1-2-4-16(15)21(27)30/h1-10H,11-12H2,(H,32,33)/p-1 |
| InChIKey | KUJLWGJXKYLTFD-UHFFFAOYSA-M |
| XLogP | 4.54 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|