C20H13Cl2NO3 — CID 46795855
[2-(2,4-dichlorophenyl)-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate (PubChem CID 46795855) has the molecular formula C20H13Cl2NO3 and a molecular weight of 386.23 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 46795855 |
| Molecular Formula | C20H13Cl2NO3 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] (E)-3-quinolin-2-ylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccc2ccccc2n1)OCC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H13Cl2NO3/c21-14-6-9-16(17(22)11-14)19(24)12-26-20(25)10-8-15-7-5-13-3-1-2-4-18(13)23-15/h1-11H,12H2/b10-8+ |
| InChIKey | WADYNOJPVVMGIB-CSKARUKUSA-N |
| XLogP | 4.98 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|