C26H24N2O3 — CID 7890532
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (E)-3-quinolin-2-ylprop-2-enoate (PubChem CID 7890532) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (E)-3-quinolin-2-ylprop-2-enoate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (E)-3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 7890532 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (E)-3-quinolin-2-ylprop-2-enoate |
| SMILES | CN1C(=CC(=O)COC(=O)/C=C/c2ccc3ccccc3n2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C26H24N2O3/c1-26(2)21-9-5-7-11-23(21)28(3)24(26)16-20(29)17-31-25(30)15-14-19-13-12-18-8-4-6-10-22(18)27-19/h4-16H,17H2,1-3H3/b15-14+,24-16? |
| InChIKey | PNZJFZQWAHNKQY-TZIXNGBXSA-N |
| XLogP | 4.67 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|