C18H19N5O2 — CID 29344600
N-[5-[(2R)-butan-2-yl]-2-hydroxyphenyl]-6-(1,2,4-triazol-4-yl)pyridine-2-carboxamide (PubChem CID 29344600) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[5-[(2R)-butan-2-yl]-2-hydroxyphenyl]-6-(1,2,4-triazol-4-yl)pyridine-2-carboxamide.
| Compound Name | N-[5-[(2R)-butan-2-yl]-2-hydroxyphenyl]-6-(1,2,4-triazol-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 29344600 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[5-[(2R)-butan-2-yl]-2-hydroxyphenyl]-6-(1,2,4-triazol-4-yl)pyridine-2-carboxamide |
| SMILES | CC[C@@H](C)c1ccc(O)c(NC(=O)c2cccc(-n3cnnc3)n2)c1 |
| InChI | InChI=1S/C18H19N5O2/c1-3-12(2)13-7-8-16(24)15(9-13)22-18(25)14-5-4-6-17(21-14)23-10-19-20-11-23/h4-12,24H,3H2,1-2H3,(H,22,25)/t12-/m1/s1 |
| InChIKey | XWJWQEHKOFTSER-GFCCVEGCSA-N |
| XLogP | 3.13 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|