C14H15NO2S2 — CID 2934940
4-[(4-ethoxy-3-methylphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-5-one (PubChem CID 2934940) has the molecular formula C14H15NO2S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 4-[(4-ethoxy-3-methylphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-5-one.
| Compound Name | 4-[(4-ethoxy-3-methylphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 2934940 |
| Molecular Formula | C14H15NO2S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-[(4-ethoxy-3-methylphenyl)methylidene]-2-methylsulfanyl-1,3-thiazol-5-one |
| SMILES | CCOc1ccc(C=C2N=C(SC)SC2=O)cc1C |
| InChI | InChI=1S/C14H15NO2S2/c1-4-17-12-6-5-10(7-9(12)2)8-11-13(16)19-14(15-11)18-3/h5-8H,4H2,1-3H3 |
| InChIKey | UFUSASGEGYYYBL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|