C18H14ClF3N2O3S — CID 2938084
N-[4-(2-chloro-1,1,2-trifluoroethoxy)phenyl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide (PubChem CID 2938084) has the molecular formula C18H14ClF3N2O3S and a molecular weight of 430.84 g/mol. Its IUPAC name is N-[4-(2-chloro-1,1,2-trifluoroethoxy)phenyl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide.
| Compound Name | N-[4-(2-chloro-1,1,2-trifluoroethoxy)phenyl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
|---|---|
| PubChem CID | 2938084 |
| Molecular Formula | C18H14ClF3N2O3S |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | N-[4-(2-chloro-1,1,2-trifluoroethoxy)phenyl]-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
| SMILES | O=C(CC1Sc2ccccc2NC1=O)Nc1ccc(OC(F)(F)C(F)Cl)cc1 |
| InChI | InChI=1S/C18H14ClF3N2O3S/c19-17(20)18(21,22)27-11-7-5-10(6-8-11)23-15(25)9-14-16(26)24-12-3-1-2-4-13(12)28-14/h1-8,14,17H,9H2,(H,23,25)(H,24,26) |
| InChIKey | JIIJMORKEAUDPT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|