C13H11ClF3N3O3S — CID 6554686
2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]-N-[4-[(2S)-2-chloro-1,1,2-trifluoroethoxy]phenyl]acetamide (PubChem CID 6554686) has the molecular formula C13H11ClF3N3O3S and a molecular weight of 381.76 g/mol. Its IUPAC name is 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]-N-[4-[(2S)-2-chloro-1,1,2-trifluoroethoxy]phenyl]acetamide.
| Compound Name | 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]-N-[4-[(2S)-2-chloro-1,1,2-trifluoroethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 6554686 |
| Molecular Formula | C13H11ClF3N3O3S |
| Molecular Weight | 381.76 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 2-[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]-N-[4-[(2S)-2-chloro-1,1,2-trifluoroethoxy]phenyl]acetamide |
| SMILES | NC1=NC(=O)[C@@H](CC(=O)Nc2ccc(OC(F)(F)[C@@H](F)Cl)cc2)S1 |
| InChI | InChI=1S/C13H11ClF3N3O3S/c14-11(15)13(16,17)23-7-3-1-6(2-4-7)19-9(21)5-8-10(22)20-12(18)24-8/h1-4,8,11H,5H2,(H,19,21)(H2,18,20,22)/t8-,11-/m1/s1 |
| InChIKey | AULUZGPHYOACPG-LDYMZIIASA-N |
| XLogP | 2.48 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.76 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|