C21H13F3N2O5S — CID 27438446
2-[(5S)-4-oxo-2-(2-oxochromen-3-yl)-1,3-thiazol-5-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 27438446) has the molecular formula C21H13F3N2O5S and a molecular weight of 462.41 g/mol. Its IUPAC name is 2-[(5S)-4-oxo-2-(2-oxochromen-3-yl)-1,3-thiazol-5-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(5S)-4-oxo-2-(2-oxochromen-3-yl)-1,3-thiazol-5-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 27438446 |
| Molecular Formula | C21H13F3N2O5S |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 2-[(5S)-4-oxo-2-(2-oxochromen-3-yl)-1,3-thiazol-5-yl]-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(C[C@@H]1SC(c2cc3ccccc3oc2=O)=NC1=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H13F3N2O5S/c22-21(23,24)31-13-7-5-12(6-8-13)25-17(27)10-16-18(28)26-19(32-16)14-9-11-3-1-2-4-15(11)30-20(14)29/h1-9,16H,10H2,(H,25,27)/t16-/m0/s1 |
| InChIKey | ZPGRZOGPDIMIMB-INIZCTEOSA-N |
| XLogP | 4.11 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|