C20H13BrN2O4S — CID 43025347
N-(2-bromophenyl)-2-[4-oxo-2-(2-oxochromen-3-yl)-1,3-thiazol-5-yl]acetamide (PubChem CID 43025347) has the molecular formula C20H13BrN2O4S and a molecular weight of 457.31 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[4-oxo-2-(2-oxochromen-3-yl)-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[4-oxo-2-(2-oxochromen-3-yl)-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 43025347 |
| Molecular Formula | C20H13BrN2O4S |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | N-(2-bromophenyl)-2-[4-oxo-2-(2-oxochromen-3-yl)-1,3-thiazol-5-yl]acetamide |
| SMILES | O=C(CC1SC(c2cc3ccccc3oc2=O)=NC1=O)Nc1ccccc1Br |
| InChI | InChI=1S/C20H13BrN2O4S/c21-13-6-2-3-7-14(13)22-17(24)10-16-18(25)23-19(28-16)12-9-11-5-1-4-8-15(11)27-20(12)26/h1-9,16H,10H2,(H,22,24) |
| InChIKey | GDUAOBYBNFJILR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|