C20H13ClN2O4S — CID 47007137
N-(4-chlorophenyl)-2-[4-oxo-2-(2-oxochromen-3-yl)-1,3-thiazol-5-yl]acetamide (PubChem CID 47007137) has the molecular formula C20H13ClN2O4S and a molecular weight of 412.85 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-oxo-2-(2-oxochromen-3-yl)-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-oxo-2-(2-oxochromen-3-yl)-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 47007137 |
| Molecular Formula | C20H13ClN2O4S |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-oxo-2-(2-oxochromen-3-yl)-1,3-thiazol-5-yl]acetamide |
| SMILES | O=C(CC1SC(c2cc3ccccc3oc2=O)=NC1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H13ClN2O4S/c21-12-5-7-13(8-6-12)22-17(24)10-16-18(25)23-19(28-16)14-9-11-3-1-2-4-15(11)27-20(14)26/h1-9,16H,10H2,(H,22,24) |
| InChIKey | RFLQQESUSCVNJU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|