C20H20Cl2N2O4 — CID 2941545
3,5-dichloro-2-[(4-methoxybenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 2941545) has the molecular formula C20H20Cl2N2O4 and a molecular weight of 423.30 g/mol. Its IUPAC name is 3,5-dichloro-2-[(4-methoxybenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3,5-dichloro-2-[(4-methoxybenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 2941545 |
| Molecular Formula | C20H20Cl2N2O4 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 3,5-dichloro-2-[(4-methoxybenzoyl)amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cc(Cl)cc2C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O4/c1-27-14-6-4-12(5-7-14)19(25)24-18-16(9-13(21)10-17(18)22)20(26)23-11-15-3-2-8-28-15/h4-7,9-10,15H,2-3,8,11H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | VJECSTJRKIJFKJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |