C22H27N3OS2 — CID 2946334
2-(1-adamantyl)-N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]acetamide (PubChem CID 2946334) has the molecular formula C22H27N3OS2 and a molecular weight of 413.61 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 2946334 |
| Molecular Formula | C22H27N3OS2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-(1-adamantyl)-N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]acetamide |
| SMILES | N#Cc1c(NC(=S)NC(=O)CC23CC4CC(CC(C4)C2)C3)sc2c1CCCC2 |
| InChI | InChI=1S/C22H27N3OS2/c23-12-17-16-3-1-2-4-18(16)28-20(17)25-21(27)24-19(26)11-22-8-13-5-14(9-22)7-15(6-13)10-22/h13-15H,1-11H2,(H2,24,25,26,27) |
| InChIKey | QCMRUMDVKILMCW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|