C16H20ClN3OS2 — CID 3459845
4-chloro-N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-4-methylpentanamide (PubChem CID 3459845) has the molecular formula C16H20ClN3OS2 and a molecular weight of 369.94 g/mol. Its IUPAC name is 4-chloro-N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-4-methylpentanamide.
| Compound Name | 4-chloro-N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 3459845 |
| Molecular Formula | C16H20ClN3OS2 |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 4-chloro-N-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioyl]-4-methylpentanamide |
| SMILES | CC(C)(Cl)CCC(=O)NC(=S)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C16H20ClN3OS2/c1-16(2,17)8-7-13(21)19-15(22)20-14-11(9-18)10-5-3-4-6-12(10)23-14/h3-8H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | VNHFJNIBLRKHMW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|