C16H19Cl3N4OS2 — CID 26723402
N-[(1S)-2,2,2-trichloro-1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioylamino]ethyl]butanamide (PubChem CID 26723402) has the molecular formula C16H19Cl3N4OS2 and a molecular weight of 453.85 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioylamino]ethyl]butanamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioylamino]ethyl]butanamide |
|---|---|
| PubChem CID | 26723402 |
| Molecular Formula | C16H19Cl3N4OS2 |
| Molecular Weight | 453.85 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamothioylamino]ethyl]butanamide |
| SMILES | CCCC(=O)N[C@@H](NC(=S)Nc1sc2c(c1C#N)CCCC2)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H19Cl3N4OS2/c1-2-5-12(24)21-14(16(17,18)19)23-15(25)22-13-10(8-20)9-6-3-4-7-11(9)26-13/h14H,2-7H2,1H3,(H,21,24)(H2,22,23,25)/t14-/m0/s1 |
| InChIKey | CQEIDCSYRBARLU-AWEZNQCLSA-N |
| XLogP | 4.40 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|