C13H14Cl3N3OS — CID 3607339
N-[2,2,2-trichloro-1-[(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]ethyl]propanamide (PubChem CID 3607339) has the molecular formula C13H14Cl3N3OS and a molecular weight of 366.70 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]ethyl]propanamide.
| Compound Name | N-[2,2,2-trichloro-1-[(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 3607339 |
| Molecular Formula | C13H14Cl3N3OS |
| Molecular Weight | 366.70 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]ethyl]propanamide |
| SMILES | CCC(=O)NC(Nc1sc2c(c1C#N)CCC2)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H14Cl3N3OS/c1-2-10(20)18-12(13(14,15)16)19-11-8(6-17)7-4-3-5-9(7)21-11/h12,19H,2-5H2,1H3,(H,18,20) |
| InChIKey | GHETYDIMCRQHPL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|