C19H18Cl3N3OS — CID 7032437
2-phenyl-N-[(1S)-2,2,2-trichloro-1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]ethyl]acetamide (PubChem CID 7032437) has the molecular formula C19H18Cl3N3OS and a molecular weight of 442.80 g/mol. Its IUPAC name is 2-phenyl-N-[(1S)-2,2,2-trichloro-1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]ethyl]acetamide.
| Compound Name | 2-phenyl-N-[(1S)-2,2,2-trichloro-1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 7032437 |
| Molecular Formula | C19H18Cl3N3OS |
| Molecular Weight | 442.80 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 2-phenyl-N-[(1S)-2,2,2-trichloro-1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]ethyl]acetamide |
| SMILES | N#Cc1c(N[C@H](NC(=O)Cc2ccccc2)C(Cl)(Cl)Cl)sc2c1CCCC2 |
| InChI | InChI=1S/C19H18Cl3N3OS/c20-19(21,22)18(24-16(26)10-12-6-2-1-3-7-12)25-17-14(11-23)13-8-4-5-9-15(13)27-17/h1-3,6-7,18,25H,4-5,8-10H2,(H,24,26)/t18-/m0/s1 |
| InChIKey | PMYBWSVKMBIJIT-SFHVURJKSA-N |
| XLogP | 4.97 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.80 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|