C18H14FN3OS2 — CID 92903820
(Z)-N-[(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)carbamothioyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 92903820) has the molecular formula C18H14FN3OS2 and a molecular weight of 371.46 g/mol. Its IUPAC name is (Z)-N-[(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)carbamothioyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (Z)-N-[(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)carbamothioyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 92903820 |
| Molecular Formula | C18H14FN3OS2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (Z)-N-[(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)carbamothioyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | N#Cc1c(NC(=S)NC(=O)/C=C\c2ccc(F)cc2)sc2c1CCC2 |
| InChI | InChI=1S/C18H14FN3OS2/c19-12-7-4-11(5-8-12)6-9-16(23)21-18(24)22-17-14(10-20)13-2-1-3-15(13)25-17/h4-9H,1-3H2,(H2,21,22,23,24)/b9-6- |
| InChIKey | PSTRRIHEBZOKPK-TWGQIWQCSA-N |
| XLogP | 3.77 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|