C21H25N3O3S2 — CID 3642413
methyl 5-[[2-(1-adamantyl)acetyl]carbamothioylamino]-4-cyano-3-methylthiophene-2-carboxylate (PubChem CID 3642413) has the molecular formula C21H25N3O3S2 and a molecular weight of 431.58 g/mol. Its IUPAC name is methyl 5-[[2-(1-adamantyl)acetyl]carbamothioylamino]-4-cyano-3-methylthiophene-2-carboxylate.
| Compound Name | methyl 5-[[2-(1-adamantyl)acetyl]carbamothioylamino]-4-cyano-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 3642413 |
| Molecular Formula | C21H25N3O3S2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | methyl 5-[[2-(1-adamantyl)acetyl]carbamothioylamino]-4-cyano-3-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NC(=S)NC(=O)CC23CC4CC(CC(C4)C2)C3)c(C#N)c1C |
| InChI | InChI=1S/C21H25N3O3S2/c1-11-15(10-22)18(29-17(11)19(26)27-2)24-20(28)23-16(25)9-21-6-12-3-13(7-21)5-14(4-12)8-21/h12-14H,3-9H2,1-2H3,(H2,23,24,25,28) |
| InChIKey | FXCRYIFUJBJMCN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|