C34H52N5O4P+2 — CID 29477
benzyl-[3-[[[3-[benzyl(diethyl)azaniumyl]propylamino]-(4-nitrophenoxy)phosphoryl]amino]propyl]-diethylazanium (PubChem CID 29477) has the molecular formula C34H52N5O4P+2 and a molecular weight of 625.80 g/mol. Its IUPAC name is benzyl-[3-[[[3-[benzyl(diethyl)azaniumyl]propylamino]-(4-nitrophenoxy)phosphoryl]amino]propyl]-diethylazanium.
| Compound Name | benzyl-[3-[[[3-[benzyl(diethyl)azaniumyl]propylamino]-(4-nitrophenoxy)phosphoryl]amino]propyl]-diethylazanium |
|---|---|
| PubChem CID | 29477 |
| Molecular Formula | C34H52N5O4P+2 |
| Molecular Weight | 625.80 g/mol |
| Exact Mass | 625.37 |
| IUPAC Name | benzyl-[3-[[[3-[benzyl(diethyl)azaniumyl]propylamino]-(4-nitrophenoxy)phosphoryl]amino]propyl]-diethylazanium |
| SMILES | CC[N+](CC)(CCCNP(=O)(NCCC[N+](CC)(CC)Cc1ccccc1)Oc1ccc([N+](=O)[O-])cc1)Cc1ccccc1 |
| InChI | InChI=1S/C34H52N5O4P/c1-5-38(6-2,29-31-17-11-9-12-18-31)27-15-25-35-44(42,43-34-23-21-33(22-24-34)37(40)41)36-26-16-28-39(7-3,8-4)30-32-19-13-10-14-20-32/h9-14,17-24H,5-8,15-16,25-30H2,1-4H3,(H2,35,36,42)/q+2 |
| InChIKey | ARSPJQHHIRDRQQ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.80 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|