About benzyl(triethyl)azanium;4-nitrophenolate
benzyl(triethyl)azanium;4-nitrophenolate (PubChem CID 14915706) has the molecular formula C19H26N2O3
and a molecular weight of 330.43 g/mol. Its IUPAC name is benzyl(triethyl)azanium;4-nitrophenolate.
Molecular Properties
| Compound Name | benzyl(triethyl)azanium;4-nitrophenolate |
| PubChem CID | 14915706 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | benzyl(triethyl)azanium;4-nitrophenolate |
| SMILES | CC[N+](CC)(CC)Cc1ccccc1.O=[N+]([O-])c1ccc([O-])cc1 |
| InChI | InChI=1S/C13H22N.C6H5NO3/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;8-6-3-1-5(2-4-6)7(9)10/h7-11H,4-6,12H2,1-3H3;1-4,8H/q+1;/p-1 |
| InChIKey | WYWQTPAPBLYEGN-UHFFFAOYSA-M |
| XLogP | 3.73 |
| TPSA | 66.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(triethyl)azanium;4-nitrophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(triethyl)azanium;4-nitrophenolate?
The IUPAC name of benzyl(triethyl)azanium;4-nitrophenolate (CID 14915706) is benzyl(triethyl)azanium;4-nitrophenolate.
What is the SMILES notation for benzyl(triethyl)azanium;4-nitrophenolate?
The canonical SMILES for benzyl(triethyl)azanium;4-nitrophenolate is CC[N+](CC)(CC)Cc1ccccc1.O=[N+]([O-])c1ccc([O-])cc1.
What is the InChIKey of benzyl(triethyl)azanium;4-nitrophenolate?
The InChIKey is WYWQTPAPBLYEGN-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H22N.C6H5NO3/c1-4-14(5-2,6-3)12-13-10-8-7-9-11-13;8-6-3-1-5(2-4-6)7(9)10/h7-11H,4-6,12H2,1-3H3;1-4,8H/q+1;/p-1.
What are the key properties of benzyl(triethyl)azanium;4-nitrophenolate?
benzyl(triethyl)azanium;4-nitrophenolate has a molecular weight of 330.43 g/mol, XLogP of 3.73, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(triethyl)azanium;4-nitrophenolate is sourced from PubChem (CID 14915706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).