C25H24ClF3N2O3 — CID 2949656
N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)cyclohexane-1-carboxamide (PubChem CID 2949656) has the molecular formula C25H24ClF3N2O3 and a molecular weight of 492.93 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)cyclohexane-1-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 2949656 |
| Molecular Formula | C25H24ClF3N2O3 |
| Molecular Weight | 492.93 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)C1CCC(N2C(=O)C3C4C=CC(C5CC45)C3C2=O)CC1 |
| InChI | InChI=1S/C25H24ClF3N2O3/c26-18-8-3-12(25(27,28)29)9-19(18)30-22(32)11-1-4-13(5-2-11)31-23(33)20-14-6-7-15(17-10-16(14)17)21(20)24(31)34/h3,6-9,11,13-17,20-21H,1-2,4-5,10H2,(H,30,32) |
| InChIKey | GJHDEJGKWLBNDO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|