C20H14FN3O4 — CID 2958701
N-[3-[(4-cyano-2-fluorobenzoyl)amino]-4-methoxyphenyl]furan-2-carboxamide (PubChem CID 2958701) has the molecular formula C20H14FN3O4 and a molecular weight of 379.35 g/mol. Its IUPAC name is N-[3-[(4-cyano-2-fluorobenzoyl)amino]-4-methoxyphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(4-cyano-2-fluorobenzoyl)amino]-4-methoxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2958701 |
| Molecular Formula | C20H14FN3O4 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[3-[(4-cyano-2-fluorobenzoyl)amino]-4-methoxyphenyl]furan-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccco2)cc1NC(=O)c1ccc(C#N)cc1F |
| InChI | InChI=1S/C20H14FN3O4/c1-27-17-7-5-13(23-20(26)18-3-2-8-28-18)10-16(17)24-19(25)14-6-4-12(11-22)9-15(14)21/h2-10H,1H3,(H,23,26)(H,24,25) |
| InChIKey | WVZGHSDTLONVSH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |