C25H17F3N4O7 — CID 2958968
2-[2-[4-nitro-2-[[2-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 2958968) has the molecular formula C25H17F3N4O7 and a molecular weight of 542.43 g/mol. Its IUPAC name is 2-[2-[4-nitro-2-[[2-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[2-[4-nitro-2-[[2-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 2958968 |
| Molecular Formula | C25H17F3N4O7 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | 2-[2-[4-nitro-2-[[2-(trifluoromethyl)phenyl]carbamoyl]anilino]ethyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(CCNc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccccc1C(F)(F)F)C2=O |
| InChI | InChI=1S/C25H17F3N4O7/c26-25(27,28)18-3-1-2-4-20(18)30-21(33)17-12-14(32(38)39)6-8-19(17)29-9-10-31-22(34)15-7-5-13(24(36)37)11-16(15)23(31)35/h1-8,11-12,29H,9-10H2,(H,30,33)(H,36,37) |
| InChIKey | XHJWCLBPYITXOV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|