C20H16N2O — CID 2959542
4,6-bis(2-phenylethenyl)-1H-pyrimidin-2-one (PubChem CID 2959542) has the molecular formula C20H16N2O and a molecular weight of 300.36 g/mol. Its IUPAC name is 4,6-bis(2-phenylethenyl)-1H-pyrimidin-2-one.
| Compound Name | 4,6-bis(2-phenylethenyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 2959542 |
| Molecular Formula | C20H16N2O |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4,6-bis(2-phenylethenyl)-1H-pyrimidin-2-one |
| SMILES | O=c1nc(C=Cc2ccccc2)cc(C=Cc2ccccc2)[nH]1 |
| InChI | InChI=1S/C20H16N2O/c23-20-21-18(13-11-16-7-3-1-4-8-16)15-19(22-20)14-12-17-9-5-2-6-10-17/h1-15H,(H,21,22,23) |
| InChIKey | DSXROUDEXNCKGZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |