C34H28N4O11P2 — CID 102290868
[4-[(E)-2-[4-[(E)-2-[4-[hydroxy-[(2-nitrophenyl)methoxy]phosphoryl]phenyl]ethenyl]-2-oxo-1H-pyrimidin-6-yl]ethenyl]phenyl]-[(2-nitrophenyl)methoxy]phosphinic acid (PubChem CID 102290868) has the molecular formula C34H28N4O11P2 and a molecular weight of 730.56 g/mol. Its IUPAC name is [4-[(E)-2-[4-[(E)-2-[4-[hydroxy-[(2-nitrophenyl)methoxy]phosphoryl]phenyl]ethenyl]-2-oxo-1H-pyrimidin-6-yl]ethenyl]phenyl]-[(2-nitrophenyl)methoxy]phosphinic acid.
| Compound Name | [4-[(E)-2-[4-[(E)-2-[4-[hydroxy-[(2-nitrophenyl)methoxy]phosphoryl]phenyl]ethenyl]-2-oxo-1H-pyrimidin-6-yl]ethenyl]phenyl]-[(2-nitrophenyl)methoxy]phosphinic acid |
|---|---|
| PubChem CID | 102290868 |
| Molecular Formula | C34H28N4O11P2 |
| Molecular Weight | 730.56 g/mol |
| Exact Mass | 730.12 |
| IUPAC Name | [4-[(E)-2-[4-[(E)-2-[4-[hydroxy-[(2-nitrophenyl)methoxy]phosphoryl]phenyl]ethenyl]-2-oxo-1H-pyrimidin-6-yl]ethenyl]phenyl]-[(2-nitrophenyl)methoxy]phosphinic acid |
| SMILES | O=c1nc(/C=C/c2ccc(P(=O)(O)OCc3ccccc3[N+](=O)[O-])cc2)cc(/C=C/c2ccc(P(=O)(O)OCc3ccccc3[N+](=O)[O-])cc2)[nH]1 |
| InChI | InChI=1S/C34H28N4O11P2/c39-34-35-28(15-9-24-11-17-30(18-12-24)50(44,45)48-22-26-5-1-3-7-32(26)37(40)41)21-29(36-34)16-10-25-13-19-31(20-14-25)51(46,47)49-23-27-6-2-4-8-33(27)38(42)43/h1-21H,22-23H2,(H,44,45)(H,46,47)(H,35,36,39)/b15-9+,16-10+ |
| InChIKey | RKUNIAAXYBTNQS-KAVGSWPWSA-N |
| XLogP | 5.98 |
| TPSA | 225.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|