C34H31N4O17P — CID 144525880
bis[(2-nitrophenyl)methyl] hydrogen phosphate;2-(2-hydroxyethyl)-3,4-bis[(2-nitrophenyl)methoxy]-2H-furan-5-one (PubChem CID 144525880) has the molecular formula C34H31N4O17P and a molecular weight of 798.61 g/mol. Its IUPAC name is bis[(2-nitrophenyl)methyl] hydrogen phosphate;2-(2-hydroxyethyl)-3,4-bis[(2-nitrophenyl)methoxy]-2H-furan-5-one.
| Compound Name | bis[(2-nitrophenyl)methyl] hydrogen phosphate;2-(2-hydroxyethyl)-3,4-bis[(2-nitrophenyl)methoxy]-2H-furan-5-one |
|---|---|
| PubChem CID | 144525880 |
| Molecular Formula | C34H31N4O17P |
| Molecular Weight | 798.61 g/mol |
| Exact Mass | 798.14 |
| IUPAC Name | bis[(2-nitrophenyl)methyl] hydrogen phosphate;2-(2-hydroxyethyl)-3,4-bis[(2-nitrophenyl)methoxy]-2H-furan-5-one |
| SMILES | O=C1OC(CCO)C(OCc2ccccc2[N+](=O)[O-])=C1OCc1ccccc1[N+](=O)[O-].O=[N+]([O-])c1ccccc1COP(=O)(O)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18N2O9.C14H13N2O8P/c23-10-9-17-18(29-11-13-5-1-3-7-15(13)21(25)26)19(20(24)31-17)30-12-14-6-2-4-8-16(14)22(27)28;17-15(18)13-7-3-1-5-11(13)9-23-25(21,22)24-10-12-6-2-4-8-14(12)16(19)20/h1-8,17,23H,9-12H2;1-8H,9-10H2,(H,21,22) |
| InChIKey | WQHUATFSUMIGSY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 293.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|