C13H8F3N3O3 — CID 2986701
4-[2-(2-nitrophenyl)ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one (PubChem CID 2986701) has the molecular formula C13H8F3N3O3 and a molecular weight of 311.22 g/mol. Its IUPAC name is 4-[2-(2-nitrophenyl)ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one.
| Compound Name | 4-[2-(2-nitrophenyl)ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 2986701 |
| Molecular Formula | C13H8F3N3O3 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 4-[2-(2-nitrophenyl)ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one |
| SMILES | O=c1nc(C=Cc2ccccc2[N+](=O)[O-])cc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C13H8F3N3O3/c14-13(15,16)11-7-9(17-12(20)18-11)6-5-8-3-1-2-4-10(8)19(21)22/h1-7H,(H,17,18,20) |
| InChIKey | CWDAIPQAMCVPFC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|